Products 596817-41-3

CAS 596817-41-3 is the registry number for (6'-Chloro-3,4,5,6-tetrahydro-2h-[1,2']bipyridinyl-4-yl)-carbamic acid tert-butyl ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(6-chloro-2-pyridinyl)piperidin-4-yl]carbamate (CAS 596817-41-3) is a chemical compound with the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. IUPAC name: tert-butyl N-[1-(6-chloro-2-pyridinyl)piperidin-4-yl]carbamate. InChIKey: MEBRPBAVCWPZKI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22ClN3O2
Molecular weight311.81 g/mol
IUPAC nametert-butyl N-[1-(6-chloro-2-pyridinyl)piperidin-4-yl]carbamate
InChIKeyMEBRPBAVCWPZKI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCN(CC1)C2=NC(=CC=C2)Cl

Computed by PubChem (NCBI)