CAS 136125-68-3 is the registry number for Methyl 2-oxo-2-(m-tolyl)acetate, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl 2-(3-methylphenyl)-2-oxoacetate (CAS 136125-68-3) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: methyl 2-(3-methylphenyl)-2-oxoacetate. InChIKey: GBPUNTYEBNYLFV-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | methyl 2-(3-methylphenyl)-2-oxoacetate |
| InChIKey | GBPUNTYEBNYLFV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)C(=O)OC |
Computed by PubChem (NCBI)