CAS 1361397-78-5 appears in our catalog under these names: 2,3,3-Trimethyl-3H-indole-4-carboxylic acid, 95%, 2,3,3-Trimethyl-3H-indole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,3,3-trimethylindole-4-carboxylic acid (CAS 1361397-78-5) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 2,3,3-trimethylindole-4-carboxylic acid. InChIKey: DLFRWILZUBBIOA-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2,3,3-trimethylindole-4-carboxylic acid |
| InChIKey | DLFRWILZUBBIOA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC(=C2C1(C)C)C(=O)O |
Computed by PubChem (NCBI)