Products 1361693-27-7
CAS 1361693-27-7 is the registry number for 6-bromo-5-(trifluoromethoxy)pyridine-3-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromo-5-(trifluoromethoxy)pyridine-3-carboxylic acid (CAS 1361693-27-7) is a chemical compound with the molecular formula C7H3BrF3NO3 and a molecular weight of 286.00 g/mol. IUPAC name: 6-bromo-5-(trifluoromethoxy)pyridine-3-carboxylic acid. InChIKey: AQAOMGKQJPUQKR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO3 |
|---|---|
| Molecular weight | 286.00 g/mol |
| IUPAC name | 6-bromo-5-(trifluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | AQAOMGKQJPUQKR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1OC(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)