CAS 1361823-44-0 is the registry number for 4-Bromo-2-methyl-6-(trifluoromethoxy)pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
4-bromo-2-methyl-6-(trifluoromethoxy)pyridine (CAS 1361823-44-0) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 4-bromo-2-methyl-6-(trifluoromethoxy)pyridine. InChIKey: UNPXWNHYMXBRPO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 4-bromo-2-methyl-6-(trifluoromethoxy)pyridine |
| InChIKey | UNPXWNHYMXBRPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)