Products 136315-77-0
CAS 136315-77-0 is the registry number for (1R,2R)-2-Aminocyclopentanecarboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
Trans-(1R,2R)-2-aminocyclopentane-1-carboxylic acid (CAS 136315-77-0) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclopentane-1-carboxylic acid. InChIKey: JWYOAMOZLZXDER-RFZPGFLSSA-N.
| Molecular formula | C6H11NO2 |
|---|---|
| Molecular weight | 129.16 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclopentane-1-carboxylic acid |
| InChIKey | JWYOAMOZLZXDER-RFZPGFLSSA-N |
| SMILES | C1C[C@H]([C@@H](C1)N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1R,2R)-2-aminocyclopentanecarboxylic acid, (1R,2R)-2-aminocyclopentane-1-carboxylic acid, Transpentacin, (-)-, trans-2-aminocyclopentanecarboxylic acid, (1R,2R)-(-)-2-Amino-1-cyclopentanecarboxylic acid, (-)-Transpentacin, (+/-)-Transpentacin, Transpentacin, (+/-)-, Cyclopentanecarboxylic acid, 2-amino-, (1R,2R)-, Cyclopentanecarboxylic acid, 2-amino-, (1R,2R)-rel-