CAS 64191-14-6 appears in our catalog under these names: (1S,2R)-2-Aminocyclopentanecarboxylic acid, 95%, (1S,2R)-2-Aminocyclopentanecarboxylic acid, 97%, (1S,2R)-2-Aminocyclopentane-1-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 500mg, 1g, 250mg.
Cis-(1S,2R)-2-aminocyclopentane-1-carboxylic acid (CAS 64191-14-6) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. IUPAC name: cis-(1S,2R)-2-aminocyclopentane-1-carboxylic acid. InChIKey: JWYOAMOZLZXDER-CRCLSJGQSA-N.
| Molecular formula | C6H11NO2 |
|---|---|
| Molecular weight | 129.16 g/mol |
| IUPAC name | cis-(1S,2R)-2-aminocyclopentane-1-carboxylic acid |
| InChIKey | JWYOAMOZLZXDER-CRCLSJGQSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)N)C(=O)O |
Computed by PubChem (NCBI)