CAS 40482-05-1 is the registry number for trans-2-Aminocyclopentanecarboxylic acid, 98+%. Offered by: AmBeed. Available pack sizes: 10g, 100mg, 5g, 250mg.
Trans-(1R,2R)-2-aminocyclopentane-1-carboxylic acid (CAS 40482-05-1) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclopentane-1-carboxylic acid. InChIKey: JWYOAMOZLZXDER-RFZPGFLSSA-N.
| Molecular formula | C6H11NO2 |
|---|---|
| Molecular weight | 129.16 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclopentane-1-carboxylic acid |
| InChIKey | JWYOAMOZLZXDER-RFZPGFLSSA-N |
| SMILES | C1C[C@H]([C@@H](C1)N)C(=O)O |
Computed by PubChem (NCBI)