CAS 1363151-64-7 is the registry number for 7-Methoxyquinazoline-4,6-diamine, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
7-methoxyquinazoline-4,6-diamine (CAS 1363151-64-7) is a chemical compound with the molecular formula C9H10N4O and a molecular weight of 190.20 g/mol. IUPAC name: 7-methoxyquinazoline-4,6-diamine. InChIKey: IMRSTHFYIIEOEA-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 7-methoxyquinazoline-4,6-diamine |
| InChIKey | IMRSTHFYIIEOEA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2N)N |
Computed by PubChem (NCBI)