CAS 1363378-16-8 is the registry number for tert-Butyl ((3R,4S)-4-(trifluoromethyl)piperidin-3-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(3R,4S)-4-(trifluoromethyl)piperidin-3-yl]carbamate (CAS 1363378-16-8) is a chemical compound with the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-(trifluoromethyl)piperidin-3-yl]carbamate. InChIKey: YKEJWMDJHSNPAU-YUMQZZPRSA-N.
| Molecular formula | C11H19F3N2O2 |
|---|---|
| Molecular weight | 268.28 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-(trifluoromethyl)piperidin-3-yl]carbamate |
| InChIKey | YKEJWMDJHSNPAU-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNCC[C@@H]1C(F)(F)F |
Computed by PubChem (NCBI)