CAS 1363381-67-2 appears in our catalog under these names: 5-Boc-5-aza-spiro[3.4]octane-2-carboxylic acid, 95%, 5-BOC-5-AZA-SPIRO(3.4)OCTANE-2-CARBOXYLIC ACID, Mixture of diastereomers, 5-(tert-Butoxycarbonyl)-5-azaspiro[3.4]octane-2-carboxylic acid 97%, 5-(tert-Butoxycarbonyl)-5-azaspiro[3.4]octane-2-carboxylic acid, 97%, 97%, 5-BOC-5-AZA-SPIRO[3.4]OCTANE-2-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g, 0,5g, 50mg, 500mg.
5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[3.4]octane-2-carboxylic acid (CAS 1363381-67-2) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[3.4]octane-2-carboxylic acid. InChIKey: JPRDSXJTSHIDCU-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[3.4]octane-2-carboxylic acid |
| InChIKey | JPRDSXJTSHIDCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CC(C2)C(=O)O |
Computed by PubChem (NCBI)