Products 1363381-80-9
CAS 1363381-80-9 is the registry number for 3-(3-Bromophenyl)oxetane-3-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(3-bromophenyl)oxetane-3-carboxylic acid (CAS 1363381-80-9) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 3-(3-bromophenyl)oxetane-3-carboxylic acid. InChIKey: CERXOJDJBZBHAO-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 3-(3-bromophenyl)oxetane-3-carboxylic acid |
| InChIKey | CERXOJDJBZBHAO-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)