CAS 1363405-28-0 appears in our catalog under these names: CIS–ETHYL 3–AMINOTETRAHYDRO–2H–PYRAN–4–CARBOXYLATE HCL, cis-Ethyl 3-aminotetrahydro-2H-pyran-4-carboxylate hydrochloride, 97%, 97%, CIS-ETHYL 3-AMINOTETRAHYDRO-2H-PYRAN-4-CARBOXYLATE HCL, 95%, cis-Ethyl 3-aminotetrahydro-2H-pyran-4-carboxylate hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg.
Ethyl (3R,4R)-3-aminooxane-4-carboxylate;hydrochloride (CAS 1363405-28-0) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: ethyl (3R,4R)-3-aminooxane-4-carboxylate;hydrochloride. InChIKey: QDMPKNIXADZTMM-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | ethyl (3R,4R)-3-aminooxane-4-carboxylate;hydrochloride |
| InChIKey | QDMPKNIXADZTMM-HHQFNNIRSA-N |
| SMILES | CCOC(=O)[C@@H]1CCOC[C@@H]1N.Cl |
Computed by PubChem (NCBI)