CAS 136382-01-9 is the registry number for 2-Bromo-1-(2-methoxy-4,6-dimethylphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-1-(2-methoxy-4,6-dimethylphenyl)ethanone (CAS 136382-01-9) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 2-bromo-1-(2-methoxy-4,6-dimethylphenyl)ethanone. InChIKey: CBXARLPEXZEGOM-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 2-bromo-1-(2-methoxy-4,6-dimethylphenyl)ethanone |
| InChIKey | CBXARLPEXZEGOM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)C(=O)CBr)C |
Computed by PubChem (NCBI)