CAS 136389-70-3 appears in our catalog under these names: {(2-(4-chlorophenyl)ethyl)sulfanyl}methanimidamide hydrochloride, 95%, {(2-(4-Chlorophenyl)ethyl)sulfanyl}methanimidamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-chlorophenyl)ethyl carbamimidothioate;hydrochloride (CAS 136389-70-3) is a chemical compound with the molecular formula C9H12Cl2N2S and a molecular weight of 251.18 g/mol. IUPAC name: 2-(4-chlorophenyl)ethyl carbamimidothioate;hydrochloride. InChIKey: XDTXLEDKCROLLM-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2S |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | 2-(4-chlorophenyl)ethyl carbamimidothioate;hydrochloride |
| InChIKey | XDTXLEDKCROLLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCSC(=N)N)Cl.Cl |
Computed by PubChem (NCBI)