CAS 2044927-24-2 is the registry number for (5-Methyl-1,3-benzothiazol-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(5-methyl-1,3-benzothiazol-2-yl)methanamine;dihydrochloride (CAS 2044927-24-2) is a chemical compound with the molecular formula C9H12Cl2N2S and a molecular weight of 251.18 g/mol. IUPAC name: (5-methyl-1,3-benzothiazol-2-yl)methanamine;dihydrochloride. InChIKey: YBZJWQPTLZOENP-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2S |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | (5-methyl-1,3-benzothiazol-2-yl)methanamine;dihydrochloride |
| InChIKey | YBZJWQPTLZOENP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)