CAS 944702-76-5 is the registry number for 5-(sec-Butyl)-4,6-dichloro-2-(methylthio)pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-butan-2-yl-4,6-dichloro-2-methylsulfanylpyrimidine (CAS 944702-76-5) is a chemical compound with the molecular formula C9H12Cl2N2S and a molecular weight of 251.18 g/mol. IUPAC name: 5-butan-2-yl-4,6-dichloro-2-methylsulfanylpyrimidine. InChIKey: AGOYHFDNYMNBFL-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2S |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | 5-butan-2-yl-4,6-dichloro-2-methylsulfanylpyrimidine |
| InChIKey | AGOYHFDNYMNBFL-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=C(N=C(N=C1Cl)SC)Cl |
Computed by PubChem (NCBI)