Products 1365243-34-0
CAS 1365243-34-0 appears in our catalog under these names: 2-(4-(1,3-Dioxolan-2-yl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%, 2-(4-(1,3-Dioxolan-2-yl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10mg, 25mg, 100mg, 250mg, 1g, 5g.
2-[4-(1,3-dioxolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1365243-34-0) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: 2-[4-(1,3-dioxolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DVDXVDUMSBCCTP-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 2-[4-(1,3-dioxolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DVDXVDUMSBCCTP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3OCCO3 |
Computed by PubChem (NCBI)