CAS 1365271-85-7 is the registry number for 1-Cyclohexyl-6-fluoro-1,2,3-benzotriazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-cyclohexyl-6-fluorobenzotriazole (CAS 1365271-85-7) is a chemical compound with the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. IUPAC name: 1-cyclohexyl-6-fluorobenzotriazole. InChIKey: CJUIUJGNAZAOSW-UHFFFAOYSA-N.
| Molecular formula | C12H14FN3 |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 1-cyclohexyl-6-fluorobenzotriazole |
| InChIKey | CJUIUJGNAZAOSW-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C3=C(C=CC(=C3)F)N=N2 |
Computed by PubChem (NCBI)