CAS 957428-73-8 is the registry number for 1-[1-(4-Fluorophenyl)-3,5-dimethyl-1h-pyrazol-4-yl]methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanamine (CAS 957428-73-8) is a chemical compound with the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. IUPAC name: [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanamine. InChIKey: JRTROBVFWOFOGT-UHFFFAOYSA-N.
| Molecular formula | C12H14FN3 |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanamine |
| InChIKey | JRTROBVFWOFOGT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)F)C)CN |
Computed by PubChem (NCBI)