CAS 885275-03-6 is the registry number for 5-Fluoro-2-piperidin-3-yl-1h-benzoimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
6-fluoro-2-piperidin-3-yl-1H-benzimidazole (CAS 885275-03-6) is a chemical compound with the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. IUPAC name: 6-fluoro-2-piperidin-3-yl-1H-benzimidazole. InChIKey: HSGAEPTYDKJILR-UHFFFAOYSA-N.
| Molecular formula | C12H14FN3 |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 6-fluoro-2-piperidin-3-yl-1H-benzimidazole |
| InChIKey | HSGAEPTYDKJILR-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NC3=C(N2)C=C(C=C3)F |
Computed by PubChem (NCBI)