CAS 1365272-15-6 is the registry number for 5-Bromo-2-(N-cyclohexylamino)-3,4-difluoroaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
5-bromo-2-N-cyclohexyl-3,4-difluorobenzene-1,2-diamine (CAS 1365272-15-6) is a chemical compound with the molecular formula C12H15BrF2N2 and a molecular weight of 305.16 g/mol. IUPAC name: 5-bromo-2-N-cyclohexyl-3,4-difluorobenzene-1,2-diamine. InChIKey: BYCNCIKBGAAWMK-UHFFFAOYSA-N.
| Molecular formula | C12H15BrF2N2 |
|---|---|
| Molecular weight | 305.16 g/mol |
| IUPAC name | 5-bromo-2-N-cyclohexyl-3,4-difluorobenzene-1,2-diamine |
| InChIKey | BYCNCIKBGAAWMK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=C(C(=C(C=C2N)Br)F)F |
Computed by PubChem (NCBI)