CAS 2279122-15-3 is the registry number for 3-Bromo-5-(4,4-difluoro-piperidin-1-ylmethyl)-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-5-[(4,4-difluoropiperidin-1-yl)methyl]aniline (CAS 2279122-15-3) is a chemical compound with the molecular formula C12H15BrF2N2 and a molecular weight of 305.16 g/mol. IUPAC name: 3-bromo-5-[(4,4-difluoropiperidin-1-yl)methyl]aniline. InChIKey: HZEXQMLECIRMGR-UHFFFAOYSA-N.
| Molecular formula | C12H15BrF2N2 |
|---|---|
| Molecular weight | 305.16 g/mol |
| IUPAC name | 3-bromo-5-[(4,4-difluoropiperidin-1-yl)methyl]aniline |
| InChIKey | HZEXQMLECIRMGR-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)CC2=CC(=CC(=C2)Br)N |
Computed by PubChem (NCBI)