CAS 2270907-74-7 is the registry number for 4-Bromo-3-(4,4-difluoro-piperidin-1-ylmethyl)-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-3-[(4,4-difluoropiperidin-1-yl)methyl]aniline (CAS 2270907-74-7) is a chemical compound with the molecular formula C12H15BrF2N2 and a molecular weight of 305.16 g/mol. IUPAC name: 4-bromo-3-[(4,4-difluoropiperidin-1-yl)methyl]aniline. InChIKey: QGOWAALLUNZCRT-UHFFFAOYSA-N.
| Molecular formula | C12H15BrF2N2 |
|---|---|
| Molecular weight | 305.16 g/mol |
| IUPAC name | 4-bromo-3-[(4,4-difluoropiperidin-1-yl)methyl]aniline |
| InChIKey | QGOWAALLUNZCRT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)CC2=C(C=CC(=C2)N)Br |
Computed by PubChem (NCBI)