CAS 90617-39-3 appears in our catalog under these names: 5-(2-Hydroxy-5-methylphenyl)-1-phenylpyrazole, 95%, 4-Methyl-2-(1-phenyl-1H-pyrazol-5-yl)phenol, 97%, 1-Phenyl-1H-5-(2'-hydroxy-5'-methylphenyl)pyrazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 50g, 250g.
4-methyl-2-(2-phenylpyrazol-3-yl)phenol (CAS 90617-39-3) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: 4-methyl-2-(2-phenylpyrazol-3-yl)phenol. InChIKey: KJQPHCSLONHFTM-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 4-methyl-2-(2-phenylpyrazol-3-yl)phenol |
| InChIKey | KJQPHCSLONHFTM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)C2=CC=NN2C3=CC=CC=C3 |
Computed by PubChem (NCBI)