CAS 1365272-42-9 is the registry number for N-Cyclopentyl 4-bromonaphthamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-bromo-N-cyclopentylnaphthalene-1-carboxamide (CAS 1365272-42-9) is a chemical compound with the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. IUPAC name: 4-bromo-N-cyclopentylnaphthalene-1-carboxamide. InChIKey: UGDBHZMDVQGZIX-UHFFFAOYSA-N.
| Molecular formula | C16H16BrNO |
|---|---|
| Molecular weight | 318.21 g/mol |
| IUPAC name | 4-bromo-N-cyclopentylnaphthalene-1-carboxamide |
| InChIKey | UGDBHZMDVQGZIX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=CC=C(C3=CC=CC=C32)Br |
Computed by PubChem (NCBI)