CAS 327082-74-6 is the registry number for 3-Bromo-2-methyl-1-(4-methylphenyl)-4,5,6,7-tetrahydro-1H-indol-4-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-bromo-2-methyl-1-(4-methylphenyl)-6,7-dihydro-5H-indol-4-one (CAS 327082-74-6) is a chemical compound with the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. IUPAC name: 3-bromo-2-methyl-1-(4-methylphenyl)-6,7-dihydro-5H-indol-4-one. InChIKey: UBWJJUNOYTYUMC-UHFFFAOYSA-N.
| Molecular formula | C16H16BrNO |
|---|---|
| Molecular weight | 318.21 g/mol |
| IUPAC name | 3-bromo-2-methyl-1-(4-methylphenyl)-6,7-dihydro-5H-indol-4-one |
| InChIKey | UBWJJUNOYTYUMC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=C(C3=C2CCCC3=O)Br)C |
Computed by PubChem (NCBI)