CAS 2750499-82-0 is the registry number for (R)-4-Benzyl-2-(bromomethyl)-3,4-dihydro-2H-benzo[b][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-4-benzyl-2-(bromomethyl)-2,3-dihydro-1,4-benzoxazine (CAS 2750499-82-0) is a chemical compound with the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. IUPAC name: (2R)-4-benzyl-2-(bromomethyl)-2,3-dihydro-1,4-benzoxazine. InChIKey: DNVLNSICGZVYEE-AWEZNQCLSA-N.
| Molecular formula | C16H16BrNO |
|---|---|
| Molecular weight | 318.21 g/mol |
| IUPAC name | (2R)-4-benzyl-2-(bromomethyl)-2,3-dihydro-1,4-benzoxazine |
| InChIKey | DNVLNSICGZVYEE-AWEZNQCLSA-N |
| SMILES | C1[C@@H](OC2=CC=CC=C2N1CC3=CC=CC=C3)CBr |
Computed by PubChem (NCBI)