CAS 1365272-72-5 is the registry number for [4-(3-Fluoro-4-methylphenyl)phenyl]acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[4-(3-fluoro-4-methylphenyl)phenyl]acetic acid (CAS 1365272-72-5) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. IUPAC name: 2-[4-(3-fluoro-4-methylphenyl)phenyl]acetic acid. InChIKey: JLIYQKWGCTXJFB-UHFFFAOYSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 2-[4-(3-fluoro-4-methylphenyl)phenyl]acetic acid |
| InChIKey | JLIYQKWGCTXJFB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=C(C=C2)CC(=O)O)F |
Computed by PubChem (NCBI)