CAS 136545-05-6 appears in our catalog under these names: 6-Bromo-2,2-dimethyl-3,4-dihydro-2h-benzo[b][1,4]oxazine, 97%, 6-Bromo-2,2-dimethyl-3,4-dihydro-2H-benzo(b)(1,4)oxazine, 98%, 6–Bromo–2, 2–dimethyl–3, 4–dihydro–2h–benzo(b)(1, 4)oxazine, 6-BROMO-2,2-DIMETHYL-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE, 98%, 98%, 6-Bromo-2,2-dimethyl-3,4-dihydro-2H-benzo[b][1,4]oxazine, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.
6-bromo-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine (CAS 136545-05-6) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine. InChIKey: WIQSBEQGGVTZRW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine |
| InChIKey | WIQSBEQGGVTZRW-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C(O1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)