Products 1365802-99-8
CAS 1365802-99-8 is the registry number for 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazolidin-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazolidin-2-one (CAS 1365802-99-8) is a chemical compound with the molecular formula C15H21BN2O3 and a molecular weight of 288.15 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazolidin-2-one. InChIKey: HESHAIKNPJNVPY-UHFFFAOYSA-N.
| Molecular formula | C15H21BN2O3 |
|---|---|
| Molecular weight | 288.15 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazolidin-2-one |
| InChIKey | HESHAIKNPJNVPY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCNC3=O |
Computed by PubChem (NCBI)