CAS 1365887-58-6 appears in our catalog under these names: (3R,4S)-4-amino-1-tert-butoxycarbonyl-pyrrolidine-3-carboxylic acid, 97%, 97%, (3R,4S)-4-Amino-1-(tert-butoxycarbonyl)pyrrolidine-3-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1365887-58-6) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (3R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: OSQJCAMJAGJCSX-RNFRBKRXSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (3R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | OSQJCAMJAGJCSX-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)N)C(=O)O |
Computed by PubChem (NCBI)