CAS 1932295-95-8 appears in our catalog under these names: (3S,4R)-4-Amino-1-(tert-butoxycarbonyl)pyrrolidine-3-carboxylic acid, 95%, 95%, (3S,4R)-4-Amino-1-(tert-butoxycarbonyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 250mg, 5g.
(3S,4R)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1932295-95-8) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (3S,4R)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: OSQJCAMJAGJCSX-BQBZGAKWSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (3S,4R)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | OSQJCAMJAGJCSX-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)N)C(=O)O |
Computed by PubChem (NCBI)