Products 136592-86-4
CAS 136592-86-4 appears in our catalog under these names: Imazamox Impurity 11, Dimethyl 3-Bromomethylpyridine-5,6-dicarboxylate. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
Dimethyl 5-(bromomethyl)pyridine-2,3-dicarboxylate (CAS 136592-86-4) is a chemical compound with the molecular formula C10H10BrNO4 and a molecular weight of 288.09 g/mol. IUPAC name: dimethyl 5-(bromomethyl)pyridine-2,3-dicarboxylate. InChIKey: ZGSOVUCMPRAGQI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4 |
|---|---|
| Molecular weight | 288.09 g/mol |
| IUPAC name | dimethyl 5-(bromomethyl)pyridine-2,3-dicarboxylate |
| InChIKey | ZGSOVUCMPRAGQI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)CBr)C(=O)OC |
Computed by PubChem (NCBI)