CAS 1365968-57-5 appears in our catalog under these names: 1-(Pyrimidin-2-yl)azetidin-3-amine dihydrochloride, 95%, 1-(Pyrimidin-2-yl)azetidin-3-amine dihydrochloride, 97%, 1-pyrimidin-2-ylazetidin-3-amine,dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 0,5g, 50mg.
1-pyrimidin-2-ylazetidin-3-amine;dihydrochloride (CAS 1365968-57-5) is a chemical compound with the molecular formula C7H12Cl2N4 and a molecular weight of 223.10 g/mol. IUPAC name: 1-pyrimidin-2-ylazetidin-3-amine;dihydrochloride. InChIKey: YRBBFKFCPGVSOH-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N4 |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 1-pyrimidin-2-ylazetidin-3-amine;dihydrochloride |
| InChIKey | YRBBFKFCPGVSOH-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=NC=CC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)