Products 951323-36-7
CAS 951323-36-7 is the registry number for N-(4-Aminophenyl)guanidine dihydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(4-aminophenyl)guanidine;dihydrochloride (CAS 951323-36-7) is a chemical compound with the molecular formula C7H12Cl2N4 and a molecular weight of 223.10 g/mol. IUPAC name: 2-(4-aminophenyl)guanidine;dihydrochloride. InChIKey: SJUGMWAHXDABPZ-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N4 |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 2-(4-aminophenyl)guanidine;dihydrochloride |
| InChIKey | SJUGMWAHXDABPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)