CAS 2243513-05-3 is the registry number for {1-Methyl-1H-pyrazolo(1,5-a)imidazol-7-yl}methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1-methylimidazo[2,1-e]pyrazol-7-yl)methanamine;dihydrochloride (CAS 2243513-05-3) is a chemical compound with the molecular formula C7H12Cl2N4 and a molecular weight of 223.10 g/mol. IUPAC name: (1-methylimidazo[2,1-e]pyrazol-7-yl)methanamine;dihydrochloride. InChIKey: XYZNTGMQIJSYOZ-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N4 |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | (1-methylimidazo[2,1-e]pyrazol-7-yl)methanamine;dihydrochloride |
| InChIKey | XYZNTGMQIJSYOZ-UHFFFAOYSA-N |
| SMILES | CN1C=CN2C1=C(C=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)