Products 1366068-26-9
CAS 1366068-26-9 is the registry number for (4-Chloro-1-naphthalenyl)-1H-indol-3-yl-methanone. Offered by: TRC. Available pack sizes: 10mg, 250mg, 50mg.
(4-chloronaphthalen-1-yl)-(1H-indol-3-yl)methanone (CAS 1366068-26-9) is a chemical compound with the molecular formula C19H12ClNO and a molecular weight of 305.8 g/mol. IUPAC name: (4-chloronaphthalen-1-yl)-(1H-indol-3-yl)methanone. InChIKey: IKDPYQGYHVDKRL-UHFFFAOYSA-N.
| Molecular formula | C19H12ClNO |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | (4-chloronaphthalen-1-yl)-(1H-indol-3-yl)methanone |
| InChIKey | IKDPYQGYHVDKRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)C(=O)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)