Products 1798799-45-7
CAS 1798799-45-7 is the registry number for 7-Chloro-2-(2-furyl)-4-phenylquinoline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
7-chloro-2-(furan-2-yl)-4-phenylquinoline (CAS 1798799-45-7) is a chemical compound with the molecular formula C19H12ClNO and a molecular weight of 305.8 g/mol. IUPAC name: 7-chloro-2-(furan-2-yl)-4-phenylquinoline. InChIKey: GSJCUBOLGSPJGV-UHFFFAOYSA-N.
| Molecular formula | C19H12ClNO |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | 7-chloro-2-(furan-2-yl)-4-phenylquinoline |
| InChIKey | GSJCUBOLGSPJGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC3=C2C=CC(=C3)Cl)C4=CC=CO4 |
Computed by PubChem (NCBI)