CAS 2671802-18-7 is the registry number for 2-(4'-Chloro-[1,1'-biphenyl]-4-yl)benzo[d]oxazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[4-(4-chlorophenyl)phenyl]-1,3-benzoxazole (CAS 2671802-18-7) is a chemical compound with the molecular formula C19H12ClNO and a molecular weight of 305.8 g/mol. IUPAC name: 2-[4-(4-chlorophenyl)phenyl]-1,3-benzoxazole. InChIKey: YPCSYZUCORAVBY-UHFFFAOYSA-N.
| Molecular formula | C19H12ClNO |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | 2-[4-(4-chlorophenyl)phenyl]-1,3-benzoxazole |
| InChIKey | YPCSYZUCORAVBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC=C(C=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)