CAS 13664-98-7 appears in our catalog under these names: 2,2-Dibromo-1-(4-methylphenyl)ethanone, 95%, 2,2–Dibromo–4'–methylacetophenone, 2,2-Dibromo-1-(4-Methylphenyl)Ethanone, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2,2-dibromo-1-(4-methylphenyl)ethanone (CAS 13664-98-7) is a chemical compound with the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. IUPAC name: 2,2-dibromo-1-(4-methylphenyl)ethanone. InChIKey: VBOWXHAZNGCXAV-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 2,2-dibromo-1-(4-methylphenyl)ethanone |
| InChIKey | VBOWXHAZNGCXAV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(Br)Br |
Computed by PubChem (NCBI)