CAS 3114-08-7 appears in our catalog under these names: 2-Bromo-1-(4-bromo-3-methylphenyl)ethanone, 98%, 2-Bromo-1-(4-bromo-3-methylphenyl)ethanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
2-bromo-1-(4-bromo-3-methylphenyl)ethanone (CAS 3114-08-7) is a chemical compound with the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. IUPAC name: 2-bromo-1-(4-bromo-3-methylphenyl)ethanone. InChIKey: KFXVSKIKSXJAJS-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 2-bromo-1-(4-bromo-3-methylphenyl)ethanone |
| InChIKey | KFXVSKIKSXJAJS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)CBr)Br |
Computed by PubChem (NCBI)