CAS 76650-08-3 appears in our catalog under these names: 2-Bromo-1-(3-bromophenyl)-1-propanone, 95%, 2,3'-Dibromopropiophenone. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg.
2-bromo-1-(3-bromophenyl)propan-1-one (CAS 76650-08-3) is a chemical compound with the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. IUPAC name: 2-bromo-1-(3-bromophenyl)propan-1-one. InChIKey: BLSYJFIEQBRDBJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 2-bromo-1-(3-bromophenyl)propan-1-one |
| InChIKey | BLSYJFIEQBRDBJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Br)Br |
Computed by PubChem (NCBI)