Products 136656-97-8
CAS 136656-97-8 is the registry number for Dexketoprofen Ethyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.
Ethyl (2S)-2-(3-benzoylphenyl)propanoate (CAS 136656-97-8) is a chemical compound with the molecular formula C18H18O3 and a molecular weight of 282.3 g/mol. IUPAC name: ethyl (2S)-2-(3-benzoylphenyl)propanoate. InChIKey: CQSMNXCTDMLMLM-ZDUSSCGKSA-N.
| Molecular formula | C18H18O3 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | ethyl (2S)-2-(3-benzoylphenyl)propanoate |
| InChIKey | CQSMNXCTDMLMLM-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)[C@@H](C)C1=CC(=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)