Products 22920-53-2

CAS 22920-53-2 is the registry number for 2,4-Dimethoxy-4′-methylchalcone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

(E)-3-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one (CAS 22920-53-2) is a chemical compound with the molecular formula C18H18O3 and a molecular weight of 282.3 g/mol. IUPAC name: (E)-3-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one. InChIKey: YRNWOYJYVPHYFY-PKNBQFBNSA-N.

Identity
Molecular formulaC18H18O3
Molecular weight282.3 g/mol
IUPAC name(E)-3-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one
InChIKeyYRNWOYJYVPHYFY-PKNBQFBNSA-N
SMILESCC1=CC=C(C=C1)C(=O)/C=C/C2=C(C=C(C=C2)OC)OC

Computed by PubChem (NCBI)