CAS 22920-53-2 is the registry number for 2,4-Dimethoxy-4′-methylchalcone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
(E)-3-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one (CAS 22920-53-2) is a chemical compound with the molecular formula C18H18O3 and a molecular weight of 282.3 g/mol. IUPAC name: (E)-3-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one. InChIKey: YRNWOYJYVPHYFY-PKNBQFBNSA-N.
| Molecular formula | C18H18O3 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | (E)-3-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one |
| InChIKey | YRNWOYJYVPHYFY-PKNBQFBNSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)/C=C/C2=C(C=C(C=C2)OC)OC |
Computed by PubChem (NCBI)