Products 136671-92-6

CAS 136671-92-6 appears in our catalog under these names: 3-(Azepan-1-yl)propanoic acid hydrochloride, 95%, 3-(Azepan-1-yl)propanoic acid hydrochloride, 3-(Azepan-1-yl)propanoic acid hydrochloride 97%, 3-(Azepan-1-yl)propanoic acid hydrochloride, 97%, 97%, 3-(1-azepanyl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

3-(azepan-1-yl)propanoic acid;hydrochloride (CAS 136671-92-6) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: 3-(azepan-1-yl)propanoic acid;hydrochloride. InChIKey: MYHZEYAIMYTASR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC name3-(azepan-1-yl)propanoic acid;hydrochloride
InChIKeyMYHZEYAIMYTASR-UHFFFAOYSA-N
SMILESC1CCCN(CC1)CCC(=O)O.Cl

Computed by PubChem (NCBI)