CAS 13669-51-7 appears in our catalog under these names: Quinolin-3-ylmethanol, 95%, Quinolin–3–ylmethanol, Quinolin-3-ylmethanol 95%, Quinolin-3-ylmethanol, 98%, 98%, Quinolin-3-ylmethanol, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 500mg, 2.5g, 25g.
Quinolin-3-ylmethanol (CAS 13669-51-7) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: quinolin-3-ylmethanol. InChIKey: FLGKQMOTLCGOQH-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | quinolin-3-ylmethanol |
| InChIKey | FLGKQMOTLCGOQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)CO |
Computed by PubChem (NCBI)