CAS 13669-52-8 is the registry number for Quinolin-3-ylmethanol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Quinolin-3-ylmethanol;hydrochloride (CAS 13669-52-8) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: quinolin-3-ylmethanol;hydrochloride. InChIKey: CVDBLIOLWUWHON-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | quinolin-3-ylmethanol;hydrochloride |
| InChIKey | CVDBLIOLWUWHON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)CO.Cl |
Computed by PubChem (NCBI)