CAS 679806-84-9 appears in our catalog under these names: 4-Pyrimidin-2-ylbenzoyl chloride, 90%, 4-Pyrimidin-2-ylbenzoyl chloride, TECH . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg.
4-pyrimidin-2-ylbenzoyl chloride (CAS 679806-84-9) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 4-pyrimidin-2-ylbenzoyl chloride. InChIKey: AQFRTZZTRGGBKO-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-pyrimidin-2-ylbenzoyl chloride |
| InChIKey | AQFRTZZTRGGBKO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)