CAS 320424-75-7 is the registry number for 3-(2-Chlorophenyl)-5-methyl-4-isoxazolecarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonitrile (CAS 320424-75-7) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonitrile. InChIKey: LRKKASBLGOQPQQ-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonitrile |
| InChIKey | LRKKASBLGOQPQQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C#N |
Computed by PubChem (NCBI)